C12H15NO4S — CID 43176544
N-(1,1-dioxothiolan-3-yl)-3-hydroxy-4-methylbenzamide (PubChem CID 43176544) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-hydroxy-4-methylbenzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-hydroxy-4-methylbenzamide |
|---|---|
| PubChem CID | 43176544 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-hydroxy-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CCS(=O)(=O)C2)cc1O |
| InChI | InChI=1S/C12H15NO4S/c1-8-2-3-9(6-11(8)14)12(15)13-10-4-5-18(16,17)7-10/h2-3,6,10,14H,4-5,7H2,1H3,(H,13,15) |
| InChIKey | GRWOGPWNJQQNET-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |