C11H13NO3S — CID 40634625
N-[(3R)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 40634625) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 40634625 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1CCS(=O)(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C11H13NO3S/c13-11(9-4-2-1-3-5-9)12-10-6-7-16(14,15)8-10/h1-5,10H,6-8H2,(H,12,13)/t10-/m1/s1 |
| InChIKey | MGNTYENVGMMMBG-SNVBAGLBSA-N |
| XLogP | 0.60 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |