C19H17NO5S — CID 7346492
N-[(3S)-1,1-dioxothiolan-3-yl]-4-(2-oxo-2-phenylacetyl)benzamide (PubChem CID 7346492) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-4-(2-oxo-2-phenylacetyl)benzamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-(2-oxo-2-phenylacetyl)benzamide |
|---|---|
| PubChem CID | 7346492 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-(2-oxo-2-phenylacetyl)benzamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)c1ccc(C(=O)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H17NO5S/c21-17(13-4-2-1-3-5-13)18(22)14-6-8-15(9-7-14)19(23)20-16-10-11-26(24,25)12-16/h1-9,16H,10-12H2,(H,20,23)/t16-/m0/s1 |
| InChIKey | QJYJDGJCFPQOSZ-INIZCTEOSA-N |
| XLogP | 1.67 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|