C14H18N2O5S2 — CID 109058398
4-(cyclopropylsulfamoyl)-N-(1,1-dioxothiolan-3-yl)benzamide (PubChem CID 109058398) has the molecular formula C14H18N2O5S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 4-(cyclopropylsulfamoyl)-N-(1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 4-(cyclopropylsulfamoyl)-N-(1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 109058398 |
| Molecular Formula | C14H18N2O5S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-(cyclopropylsulfamoyl)-N-(1,1-dioxothiolan-3-yl)benzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C14H18N2O5S2/c17-14(15-12-7-8-22(18,19)9-12)10-1-5-13(6-2-10)23(20,21)16-11-3-4-11/h1-2,5-6,11-12,16H,3-4,7-9H2,(H,15,17) |
| InChIKey | OKJSBYARPSLGTE-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |