C11H13NO6S2 — CID 2858778
4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoic acid (PubChem CID 2858778) has the molecular formula C11H13NO6S2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoic acid.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 2858778 |
| Molecular Formula | C11H13NO6S2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C11H13NO6S2/c13-11(14)8-1-3-10(4-2-8)20(17,18)12-9-5-6-19(15,16)7-9/h1-4,9,12H,5-7H2,(H,13,14) |
| InChIKey | PANIHRKSOILEGJ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |