C21H23N3O6S2 — CID 26002695
4-[[(3R)-1,1-dioxothiolan-3-yl]sulfamoyl]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide (PubChem CID 26002695) has the molecular formula C21H23N3O6S2 and a molecular weight of 477.56 g/mol. Its IUPAC name is 4-[[(3R)-1,1-dioxothiolan-3-yl]sulfamoyl]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide.
| Compound Name | 4-[[(3R)-1,1-dioxothiolan-3-yl]sulfamoyl]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 26002695 |
| Molecular Formula | C21H23N3O6S2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 4-[[(3R)-1,1-dioxothiolan-3-yl]sulfamoyl]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(N2CCCC2=O)c1)c1ccc(S(=O)(=O)N[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H23N3O6S2/c25-20-5-2-11-24(20)18-4-1-3-16(13-18)22-21(26)15-6-8-19(9-7-15)32(29,30)23-17-10-12-31(27,28)14-17/h1,3-4,6-9,13,17,23H,2,5,10-12,14H2,(H,22,26)/t17-/m1/s1 |
| InChIKey | HOIWBNKDJGEXHE-QGZVFWFLSA-N |
| XLogP | 1.53 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |