C17H16F2N2O5S2 — CID 24598177
N-(3,5-difluorophenyl)-3-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzamide (PubChem CID 24598177) has the molecular formula C17H16F2N2O5S2 and a molecular weight of 430.45 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-3-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzamide.
| Compound Name | N-(3,5-difluorophenyl)-3-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 24598177 |
| Molecular Formula | C17H16F2N2O5S2 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-(3,5-difluorophenyl)-3-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)c1cccc(S(=O)(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C17H16F2N2O5S2/c18-12-7-13(19)9-15(8-12)20-17(22)11-2-1-3-16(6-11)28(25,26)21-14-4-5-27(23,24)10-14/h1-3,6-9,14,21H,4-5,10H2,(H,20,22) |
| InChIKey | QVLMSBJTIRTQGB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |