C20H24N2O7S2 — CID 24571136
3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(4-ethoxy-3-methoxyphenyl)benzamide (PubChem CID 24571136) has the molecular formula C20H24N2O7S2 and a molecular weight of 468.55 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(4-ethoxy-3-methoxyphenyl)benzamide.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(4-ethoxy-3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 24571136 |
| Molecular Formula | C20H24N2O7S2 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(4-ethoxy-3-methoxyphenyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)c2cccc(S(=O)(=O)NC3CCS(=O)(=O)C3)c2)cc1OC |
| InChI | InChI=1S/C20H24N2O7S2/c1-3-29-18-8-7-15(12-19(18)28-2)21-20(23)14-5-4-6-17(11-14)31(26,27)22-16-9-10-30(24,25)13-16/h4-8,11-12,16,22H,3,9-10,13H2,1-2H3,(H,21,23) |
| InChIKey | FPLNJXGRUHGBJI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |