C14H19NO5S — CID 27710236
N-[(3R)-1,1-dioxothiolan-3-yl]-4-ethoxy-3-methoxybenzamide (PubChem CID 27710236) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-4-ethoxy-3-methoxybenzamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-4-ethoxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 27710236 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-4-ethoxy-3-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N[C@@H]2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C14H19NO5S/c1-3-20-12-5-4-10(8-13(12)19-2)14(16)15-11-6-7-21(17,18)9-11/h4-5,8,11H,3,6-7,9H2,1-2H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | XLGVGHASZREYEO-LLVKDONJSA-N |
| XLogP | 1.01 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |