C16H22N2O6S — CID 7663377
N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]oxyacetamide (PubChem CID 7663377) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]oxyacetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 7663377 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]oxyacetamide |
| SMILES | CCOc1ccc(/C=N\OCC(=O)N[C@H]2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C16H22N2O6S/c1-3-23-14-5-4-12(8-15(14)22-2)9-17-24-10-16(19)18-13-6-7-25(20,21)11-13/h4-5,8-9,13H,3,6-7,10-11H2,1-2H3,(H,18,19)/b17-9-/t13-/m0/s1 |
| InChIKey | RCYPOKVAYKFVIP-OLWAXZHHSA-N |
| XLogP | 0.75 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|