C20H27NO7S — CID 8738968
[(2S)-1-[[(3R)-1,1-dioxothiolan-3-yl]amino]-1-oxopropan-2-yl] (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate (PubChem CID 8738968) has the molecular formula C20H27NO7S and a molecular weight of 425.50 g/mol. Its IUPAC name is [(2S)-1-[[(3R)-1,1-dioxothiolan-3-yl]amino]-1-oxopropan-2-yl] (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-[[(3R)-1,1-dioxothiolan-3-yl]amino]-1-oxopropan-2-yl] (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8738968 |
| Molecular Formula | C20H27NO7S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [(2S)-1-[[(3R)-1,1-dioxothiolan-3-yl]amino]-1-oxopropan-2-yl] (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccc(/C=C/C(=O)O[C@@H](C)C(=O)N[C@@H]2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C20H27NO7S/c1-4-10-27-17-7-5-15(12-18(17)26-3)6-8-19(22)28-14(2)20(23)21-16-9-11-29(24,25)13-16/h5-8,12,14,16H,4,9-11,13H2,1-3H3,(H,21,23)/b8-6+/t14-,16+/m0/s1 |
| InChIKey | WGXBAPCUANZWBO-AFDQWNBZSA-N |
| XLogP | 1.73 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|