C17H19F2NO5 — CID 7199115
[(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 7199115) has the molecular formula C17H19F2NO5 and a molecular weight of 355.34 g/mol. Its IUPAC name is [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7199115 |
| Molecular Formula | C17H19F2NO5 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@H](C)C(=O)NC2CC2)ccc1OC(F)F |
| InChI | InChI=1S/C17H19F2NO5/c1-10(16(22)20-12-5-6-12)24-15(21)8-4-11-3-7-13(25-17(18)19)14(9-11)23-2/h3-4,7-10,12,17H,5-6H2,1-2H3,(H,20,22)/b8-4+/t10-/m1/s1 |
| InChIKey | XBMZJVJSJVKXBQ-VMKBVTSJSA-N |
| XLogP | 2.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|