C16H18BrNO5 — CID 8656243
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 8656243) has the molecular formula C16H18BrNO5 and a molecular weight of 384.23 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8656243 |
| Molecular Formula | C16H18BrNO5 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H](C)C(=O)NC2CC2)cc(Br)c1O |
| InChI | InChI=1S/C16H18BrNO5/c1-9(16(21)18-11-4-5-11)23-14(19)6-3-10-7-12(17)15(20)13(8-10)22-2/h3,6-9,11,20H,4-5H2,1-2H3,(H,18,21)/b6-3+/t9-/m0/s1 |
| InChIKey | IOMPUUUCTUTSNR-SWTNXBIASA-N |
| XLogP | 2.39 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|