C20H26ClNO5 — CID 7683950
[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 7683950) has the molecular formula C20H26ClNO5 and a molecular weight of 395.88 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7683950 |
| Molecular Formula | C20H26ClNO5 |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)O[C@H](C)C(=O)NC2CCCC2)cc1OC |
| InChI | InChI=1S/C20H26ClNO5/c1-4-26-19-16(21)11-14(12-17(19)25-3)9-10-18(23)27-13(2)20(24)22-15-7-5-6-8-15/h9-13,15H,4-8H2,1-3H3,(H,22,24)/b10-9+/t13-/m1/s1 |
| InChIKey | HKPNNDMKRRYMQF-WTNCMQEWSA-N |
| XLogP | 3.75 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|