C19H26ClNO5 — CID 8576195
[(2S)-1-(2-methylpropylamino)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 8576195) has the molecular formula C19H26ClNO5 and a molecular weight of 383.87 g/mol. Its IUPAC name is [(2S)-1-(2-methylpropylamino)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(2-methylpropylamino)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8576195 |
| Molecular Formula | C19H26ClNO5 |
| Molecular Weight | 383.87 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [(2S)-1-(2-methylpropylamino)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)O[C@@H](C)C(=O)NCC(C)C)cc1OC |
| InChI | InChI=1S/C19H26ClNO5/c1-6-25-18-15(20)9-14(10-16(18)24-5)7-8-17(22)26-13(4)19(23)21-11-12(2)3/h7-10,12-13H,6,11H2,1-5H3,(H,21,23)/b8-7+/t13-/m0/s1 |
| InChIKey | WJTXDTGIOIUKLI-GWJCSSMESA-N |
| XLogP | 3.46 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.87 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|