C24H28ClNO6 — CID 55422546
[1-[2-(4-methoxyphenyl)ethylamino]-1-oxopropan-2-yl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 55422546) has the molecular formula C24H28ClNO6 and a molecular weight of 461.94 g/mol. Its IUPAC name is [1-[2-(4-methoxyphenyl)ethylamino]-1-oxopropan-2-yl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [1-[2-(4-methoxyphenyl)ethylamino]-1-oxopropan-2-yl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55422546 |
| Molecular Formula | C24H28ClNO6 |
| Molecular Weight | 461.94 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [1-[2-(4-methoxyphenyl)ethylamino]-1-oxopropan-2-yl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OC(C)C(=O)NCCc2ccc(OC)cc2)cc(Cl)c1OC |
| InChI | InChI=1S/C24H28ClNO6/c1-5-31-21-15-18(14-20(25)23(21)30-4)8-11-22(27)32-16(2)24(28)26-13-12-17-6-9-19(29-3)10-7-17/h6-11,14-16H,5,12-13H2,1-4H3,(H,26,28)/b11-8+ |
| InChIKey | JOHFNGHSBYDAOH-DHZHZOJOSA-N |
| XLogP | 4.06 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.94 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|