C23H27ClN2O6 — CID 55344133
N'-[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]-2-(4-ethoxyphenoxy)propanehydrazide (PubChem CID 55344133) has the molecular formula C23H27ClN2O6 and a molecular weight of 462.93 g/mol. Its IUPAC name is N'-[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]-2-(4-ethoxyphenoxy)propanehydrazide.
| Compound Name | N'-[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]-2-(4-ethoxyphenoxy)propanehydrazide |
|---|---|
| PubChem CID | 55344133 |
| Molecular Formula | C23H27ClN2O6 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N'-[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]-2-(4-ethoxyphenoxy)propanehydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)/C=C/c2cc(Cl)c(OC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C23H27ClN2O6/c1-5-30-17-8-10-18(11-9-17)32-15(3)23(28)26-25-21(27)12-7-16-13-19(24)22(29-4)20(14-16)31-6-2/h7-15H,5-6H2,1-4H3,(H,25,27)(H,26,28)/b12-7+ |
| InChIKey | IBDDXPVYDDNRFN-KPKJPENVSA-N |
| XLogP | 3.77 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|