C17H24ClNO3 — CID 42979719
(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-pentan-2-ylprop-2-enamide (PubChem CID 42979719) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-pentan-2-ylprop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-pentan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 42979719 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-pentan-2-ylprop-2-enamide |
| SMILES | CCCC(C)NC(=O)/C=C/c1cc(Cl)c(OC)c(OCC)c1 |
| InChI | InChI=1S/C17H24ClNO3/c1-5-7-12(3)19-16(20)9-8-13-10-14(18)17(21-4)15(11-13)22-6-2/h8-12H,5-7H2,1-4H3,(H,19,20)/b9-8+ |
| InChIKey | LDUHPSWDRKSQNN-CMDGGOBGSA-N |
| XLogP | 4.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|