C21H23ClFNO3 — CID 46647636
(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[1-(4-fluorophenyl)ethyl]-N-methylprop-2-enamide (PubChem CID 46647636) has the molecular formula C21H23ClFNO3 and a molecular weight of 391.87 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[1-(4-fluorophenyl)ethyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[1-(4-fluorophenyl)ethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 46647636 |
| Molecular Formula | C21H23ClFNO3 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[1-(4-fluorophenyl)ethyl]-N-methylprop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)N(C)C(C)c2ccc(F)cc2)cc(Cl)c1OC |
| InChI | InChI=1S/C21H23ClFNO3/c1-5-27-19-13-15(12-18(22)21(19)26-4)6-11-20(25)24(3)14(2)16-7-9-17(23)10-8-16/h6-14H,5H2,1-4H3/b11-6+ |
| InChIKey | XBXBWTGKDFUGHW-IZZDOVSWSA-N |
| XLogP | 5.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|