C20H21Cl2NO3 — CID 30731457
(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[(2-chlorophenyl)methyl]-N-methylprop-2-enamide (PubChem CID 30731457) has the molecular formula C20H21Cl2NO3 and a molecular weight of 394.30 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[(2-chlorophenyl)methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[(2-chlorophenyl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 30731457 |
| Molecular Formula | C20H21Cl2NO3 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[(2-chlorophenyl)methyl]-N-methylprop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)N(C)Cc2ccccc2Cl)cc(Cl)c1OC |
| InChI | InChI=1S/C20H21Cl2NO3/c1-4-26-18-12-14(11-17(22)20(18)25-3)9-10-19(24)23(2)13-15-7-5-6-8-16(15)21/h5-12H,4,13H2,1-3H3/b10-9+ |
| InChIKey | YHRDZMSVIMFPQI-MDZDMXLPSA-N |
| XLogP | 5.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|