C20H21ClO5 — CID 7757722
(2-ethoxyphenyl)methyl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 7757722) has the molecular formula C20H21ClO5 and a molecular weight of 376.84 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (2-ethoxyphenyl)methyl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7757722 |
| Molecular Formula | C20H21ClO5 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (2-ethoxyphenyl)methyl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccccc1COC(=O)/C=C/c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H21ClO5/c1-4-25-17-8-6-5-7-15(17)13-26-19(22)10-9-14-11-16(21)20(24-3)18(12-14)23-2/h5-12H,4,13H2,1-3H3/b10-9+ |
| InChIKey | RQXJDETWDXRVBX-MDZDMXLPSA-N |
| XLogP | 4.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|