C19H18ClIO4 — CID 91685115
ethyl (E)-3-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enoate (PubChem CID 91685115) has the molecular formula C19H18ClIO4 and a molecular weight of 472.71 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91685115 |
| Molecular Formula | C19H18ClIO4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | ethyl (E)-3-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(I)c(OCc2ccccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C19H18ClIO4/c1-3-24-18(22)9-8-13-10-16(21)19(17(11-13)23-2)25-12-14-6-4-5-7-15(14)20/h4-11H,3,12H2,1-2H3/b9-8+ |
| InChIKey | LZEZMDHFKXSTIQ-CMDGGOBGSA-N |
| XLogP | 5.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|