C19H18BrClO4 — CID 102535059
methyl (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoate (PubChem CID 102535059) has the molecular formula C19H18BrClO4 and a molecular weight of 425.71 g/mol. Its IUPAC name is methyl (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 102535059 |
| Molecular Formula | C19H18BrClO4 |
| Molecular Weight | 425.71 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | methyl (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OC)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C19H18BrClO4/c1-3-24-17-11-13(8-9-18(22)23-2)10-15(20)19(17)25-12-14-6-4-5-7-16(14)21/h4-11H,3,12H2,1-2H3/b9-8+ |
| InChIKey | NYKKNAZQXSFPNZ-CMDGGOBGSA-N |
| XLogP | 5.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.71 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|