C24H20Br2ClNO3 — CID 53267093
(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3-bromophenyl)prop-2-enamide (PubChem CID 53267093) has the molecular formula C24H20Br2ClNO3 and a molecular weight of 565.69 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3-bromophenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3-bromophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53267093 |
| Molecular Formula | C24H20Br2ClNO3 |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 562.95 |
| IUPAC Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3-bromophenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2cccc(Br)c2)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H20Br2ClNO3/c1-2-30-22-13-16(10-11-23(29)28-19-8-5-7-18(25)14-19)12-20(26)24(22)31-15-17-6-3-4-9-21(17)27/h3-14H,2,15H2,1H3,(H,28,29)/b11-10+ |
| InChIKey | QCIXHXMLOCQVFW-ZHACJKMWSA-N |
| XLogP | 7.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|