C28H27BrClNO5 — CID 53267023
propyl 4-[[(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoyl]amino]benzoate (PubChem CID 53267023) has the molecular formula C28H27BrClNO5 and a molecular weight of 572.88 g/mol. Its IUPAC name is propyl 4-[[(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | propyl 4-[[(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 53267023 |
| Molecular Formula | C28H27BrClNO5 |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | propyl 4-[[(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)/C=C/c2cc(Br)c(OCc3ccccc3Cl)c(OCC)c2)cc1 |
| InChI | InChI=1S/C28H27BrClNO5/c1-3-15-35-28(33)20-10-12-22(13-11-20)31-26(32)14-9-19-16-23(29)27(25(17-19)34-4-2)36-18-21-7-5-6-8-24(21)30/h5-14,16-17H,3-4,15,18H2,1-2H3,(H,31,32)/b14-9+ |
| InChIKey | PMDUKSHKRDZHDJ-NTEUORMPSA-N |
| XLogP | 7.30 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|