C24H20BrClN2O5 — CID 53267018
(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 53267018) has the molecular formula C24H20BrClN2O5 and a molecular weight of 531.79 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53267018 |
| Molecular Formula | C24H20BrClN2O5 |
| Molecular Weight | 531.79 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2cccc([N+](=O)[O-])c2)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H20BrClN2O5/c1-2-32-22-13-16(10-11-23(29)27-18-7-5-8-19(14-18)28(30)31)12-20(25)24(22)33-15-17-6-3-4-9-21(17)26/h3-14H,2,15H2,1H3,(H,27,29)/b11-10+ |
| InChIKey | BHKLATFMGKUYLF-ZHACJKMWSA-N |
| XLogP | 6.64 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.79 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|