C28H25BrClN3O6S — CID 53267357
(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 53267357) has the molecular formula C28H25BrClN3O6S and a molecular weight of 646.95 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 53267357 |
| Molecular Formula | C28H25BrClN3O6S |
| Molecular Weight | 646.95 g/mol |
| Exact Mass | 645.03 |
| IUPAC Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2ccc(S(=O)(=O)Nc3cc(C)on3)cc2)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C28H25BrClN3O6S/c1-3-37-25-16-19(15-23(29)28(25)38-17-20-6-4-5-7-24(20)30)8-13-27(34)31-21-9-11-22(12-10-21)40(35,36)33-26-14-18(2)39-32-26/h4-16H,3,17H2,1-2H3,(H,31,34)(H,32,33)/b13-8+ |
| InChIKey | CWPLRQWUXVPBKP-MDWZMJQESA-N |
| XLogP | 6.83 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.95 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|