C26H31N3O6S — CID 19185149
(E)-3-(4-hexoxy-3-methoxyphenyl)-N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 19185149) has the molecular formula C26H31N3O6S and a molecular weight of 513.62 g/mol. Its IUPAC name is (E)-3-(4-hexoxy-3-methoxyphenyl)-N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-hexoxy-3-methoxyphenyl)-N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 19185149 |
| Molecular Formula | C26H31N3O6S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | (E)-3-(4-hexoxy-3-methoxyphenyl)-N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | CCCCCCOc1ccc(/C=C/C(=O)Nc2ccc(S(=O)(=O)Nc3cc(C)on3)cc2)cc1OC |
| InChI | InChI=1S/C26H31N3O6S/c1-4-5-6-7-16-34-23-14-8-20(18-24(23)33-3)9-15-26(30)27-21-10-12-22(13-11-21)36(31,32)29-25-17-19(2)35-28-25/h8-15,17-18H,4-7,16H2,1-3H3,(H,27,30)(H,28,29)/b15-9+ |
| InChIKey | MDXQUHJJKRZVLS-OQLLNIDSSA-N |
| XLogP | 5.40 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|