C21H26N2O5S — CID 2071589
(E)-3-(4-butoxy-3-ethoxyphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 2071589) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is (E)-3-(4-butoxy-3-ethoxyphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(4-butoxy-3-ethoxyphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2071589 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (E)-3-(4-butoxy-3-ethoxyphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | CCCCOc1ccc(/C=C/C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1OCC |
| InChI | InChI=1S/C21H26N2O5S/c1-3-5-14-28-19-12-6-16(15-20(19)27-4-2)7-13-21(24)23-17-8-10-18(11-9-17)29(22,25)26/h6-13,15H,3-5,14H2,1-2H3,(H,23,24)(H2,22,25,26)/b13-7+ |
| InChIKey | XZRINLJACFCSET-NTUHNPAUSA-N |
| XLogP | 3.56 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|