C23H28N2O6 — CID 55744196
N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-3-(4-butoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 55744196) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-3-(4-butoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-3-(4-butoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55744196 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-3-(4-butoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCCCOc1ccc(C=CC(=O)Nc2ccc(OC)c(OCC(N)=O)c2)cc1OC |
| InChI | InChI=1S/C23H28N2O6/c1-4-5-12-30-19-9-6-16(13-20(19)29-3)7-11-23(27)25-17-8-10-18(28-2)21(14-17)31-15-22(24)26/h6-11,13-14H,4-5,12,15H2,1-3H3,(H2,24,26)(H,25,27) |
| InChIKey | UTGWTTITVRIGQX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|