C20H22N2O4 — CID 36676916
(E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(3,4-dimethylphenyl)prop-2-enamide (PubChem CID 36676916) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(3,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(3,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 36676916 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(3,4-dimethylphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(C)c(C)c2)ccc1OCC(N)=O |
| InChI | InChI=1S/C20H22N2O4/c1-13-4-7-16(10-14(13)2)22-20(24)9-6-15-5-8-17(18(11-15)25-3)26-12-19(21)23/h4-11H,12H2,1-3H3,(H2,21,23)(H,22,24)/b9-6+ |
| InChIKey | CIISLMHRFPINIK-RMKNXTFCSA-N |
| XLogP | 2.83 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|