C26H36N2O3 — CID 70143460
(E)-3-(3,4-dimethylphenyl)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]prop-2-enamide (PubChem CID 70143460) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is (E)-3-(3,4-dimethylphenyl)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethylphenyl)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70143460 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | (E)-3-(3,4-dimethylphenyl)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2ccc(C)c(C)c2)cc1OCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C26H36N2O3/c1-18(2)28(19(3)4)14-15-31-25-17-23(11-12-24(25)30-7)27-26(29)13-10-22-9-8-20(5)21(6)16-22/h8-13,16-19H,14-15H2,1-7H3,(H,27,29)/b13-10+ |
| InChIKey | ZJKKQJRPIPAMGT-JLHYYAGUSA-N |
| XLogP | 5.46 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|