C24H30F2N2O3 — CID 54229269
3-(2,4-difluorophenyl)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]prop-2-enamide (PubChem CID 54229269) has the molecular formula C24H30F2N2O3 and a molecular weight of 432.51 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | 3-(2,4-difluorophenyl)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 54229269 |
| Molecular Formula | C24H30F2N2O3 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 3-(2,4-difluorophenyl)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)C=Cc2ccc(F)cc2F)cc1OCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C24H30F2N2O3/c1-16(2)28(17(3)4)12-13-31-23-15-20(9-10-22(23)30-5)27-24(29)11-7-18-6-8-19(25)14-21(18)26/h6-11,14-17H,12-13H2,1-5H3,(H,27,29) |
| InChIKey | QIBWLIMPENJEOP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|