C25H32ClFN2O2 — CID 70148141
(E)-3-(4-chloro-2-fluorophenyl)-N-[3-[3-[di(propan-2-yl)amino]propyl]-4-methoxyphenyl]prop-2-enamide (PubChem CID 70148141) has the molecular formula C25H32ClFN2O2 and a molecular weight of 446.99 g/mol. Its IUPAC name is (E)-3-(4-chloro-2-fluorophenyl)-N-[3-[3-[di(propan-2-yl)amino]propyl]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chloro-2-fluorophenyl)-N-[3-[3-[di(propan-2-yl)amino]propyl]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70148141 |
| Molecular Formula | C25H32ClFN2O2 |
| Molecular Weight | 446.99 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (E)-3-(4-chloro-2-fluorophenyl)-N-[3-[3-[di(propan-2-yl)amino]propyl]-4-methoxyphenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2ccc(Cl)cc2F)cc1CCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C25H32ClFN2O2/c1-17(2)29(18(3)4)14-6-7-20-15-22(11-12-24(20)31-5)28-25(30)13-9-19-8-10-21(26)16-23(19)27/h8-13,15-18H,6-7,14H2,1-5H3,(H,28,30)/b13-9+ |
| InChIKey | NIQOATOLKAEVMS-UKTHLTGXSA-N |
| XLogP | 6.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.99 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|