C23H32N2O4 — CID 54281713
N-[3-[3-[di(propan-2-yl)amino]propoxy]-4-methoxyphenyl]-3-(furan-3-yl)prop-2-enamide (PubChem CID 54281713) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[3-[3-[di(propan-2-yl)amino]propoxy]-4-methoxyphenyl]-3-(furan-3-yl)prop-2-enamide.
| Compound Name | N-[3-[3-[di(propan-2-yl)amino]propoxy]-4-methoxyphenyl]-3-(furan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 54281713 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | N-[3-[3-[di(propan-2-yl)amino]propoxy]-4-methoxyphenyl]-3-(furan-3-yl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)C=Cc2ccoc2)cc1OCCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C23H32N2O4/c1-17(2)25(18(3)4)12-6-13-29-22-15-20(8-9-21(22)27-5)24-23(26)10-7-19-11-14-28-16-19/h7-11,14-18H,6,12-13H2,1-5H3,(H,24,26) |
| InChIKey | RRFUJYYODQGBLE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|