C25H32Cl2N2O3 — CID 139919476
3-(3,4-dichlorophenyl)-N-[3-[3-[di(propan-2-yl)amino]propoxy]-4-methoxyphenyl]prop-2-enamide (PubChem CID 139919476) has the molecular formula C25H32Cl2N2O3 and a molecular weight of 479.45 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[3-[3-[di(propan-2-yl)amino]propoxy]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[3-[3-[di(propan-2-yl)amino]propoxy]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139919476 |
| Molecular Formula | C25H32Cl2N2O3 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[3-[3-[di(propan-2-yl)amino]propoxy]-4-methoxyphenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)C=Cc2ccc(Cl)c(Cl)c2)cc1OCCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C25H32Cl2N2O3/c1-17(2)29(18(3)4)13-6-14-32-24-16-20(9-11-23(24)31-5)28-25(30)12-8-19-7-10-21(26)22(27)15-19/h7-12,15-18H,6,13-14H2,1-5H3,(H,28,30) |
| InChIKey | HSSLCDYKJKVCDU-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|