C25H31F3N2O3 — CID 70143148
(E)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 70143148) has the molecular formula C25H31F3N2O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is (E)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70143148 |
| Molecular Formula | C25H31F3N2O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (E)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2ccc(C(F)(F)F)cc2)cc1OCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C25H31F3N2O3/c1-17(2)30(18(3)4)14-15-33-23-16-21(11-12-22(23)32-5)29-24(31)13-8-19-6-9-20(10-7-19)25(26,27)28/h6-13,16-18H,14-15H2,1-5H3,(H,29,31)/b13-8+ |
| InChIKey | NCUMGBLUFZNWAE-MDWZMJQESA-N |
| XLogP | 5.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|