C28H34N2O2 — CID 70145300
N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methylphenyl]-3-naphthalen-2-ylprop-2-enamide (PubChem CID 70145300) has the molecular formula C28H34N2O2 and a molecular weight of 430.59 g/mol. Its IUPAC name is N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methylphenyl]-3-naphthalen-2-ylprop-2-enamide.
| Compound Name | N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methylphenyl]-3-naphthalen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 70145300 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methylphenyl]-3-naphthalen-2-ylprop-2-enamide |
| SMILES | Cc1ccc(NC(=O)C=Cc2ccc3ccccc3c2)cc1OCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C28H34N2O2/c1-20(2)30(21(3)4)16-17-32-27-19-26(14-10-22(27)5)29-28(31)15-12-23-11-13-24-8-6-7-9-25(24)18-23/h6-15,18-21H,16-17H2,1-5H3,(H,29,31) |
| InChIKey | FJCCSMXPOTYVDK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|