C22H18N2O3 — CID 4851858
3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-naphthalen-2-ylprop-2-enamide (PubChem CID 4851858) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-naphthalen-2-ylprop-2-enamide.
| Compound Name | 3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-naphthalen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4851858 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-naphthalen-2-ylprop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccc3ccccc3c2)ccc1OCC#N |
| InChI | InChI=1S/C22H18N2O3/c1-26-21-14-16(6-10-20(21)27-13-12-23)7-11-22(25)24-19-9-8-17-4-2-3-5-18(17)15-19/h2-11,14-15H,13H2,1H3,(H,24,25) |
| InChIKey | ZKTNCUMGFKONNY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|