C18H15IN2O3 — CID 4573214
3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(4-iodophenyl)prop-2-enamide (PubChem CID 4573214) has the molecular formula C18H15IN2O3 and a molecular weight of 434.23 g/mol. Its IUPAC name is 3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(4-iodophenyl)prop-2-enamide.
| Compound Name | 3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(4-iodophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4573214 |
| Molecular Formula | C18H15IN2O3 |
| Molecular Weight | 434.23 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | 3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(4-iodophenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccc(I)cc2)ccc1OCC#N |
| InChI | InChI=1S/C18H15IN2O3/c1-23-17-12-13(2-8-16(17)24-11-10-20)3-9-18(22)21-15-6-4-14(19)5-7-15/h2-9,12H,11H2,1H3,(H,21,22) |
| InChIKey | CRUZRAMPZJAACQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|