C18H13F3N2O3 — CID 7958706
(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(2,3,4-trifluorophenyl)prop-2-enamide (PubChem CID 7958706) has the molecular formula C18H13F3N2O3 and a molecular weight of 362.31 g/mol. Its IUPAC name is (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(2,3,4-trifluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(2,3,4-trifluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7958706 |
| Molecular Formula | C18H13F3N2O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(2,3,4-trifluorophenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(F)c(F)c2F)ccc1OCC#N |
| InChI | InChI=1S/C18H13F3N2O3/c1-25-15-10-11(2-6-14(15)26-9-8-22)3-7-16(24)23-13-5-4-12(19)17(20)18(13)21/h2-7,10H,9H2,1H3,(H,23,24)/b7-3+ |
| InChIKey | VMHDVRGGQXRGFL-XVNBXDOJSA-N |
| XLogP | 3.67 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|