C24H20N2O3S — CID 55493412
(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(2-phenylsulfanylphenyl)prop-2-enamide (PubChem CID 55493412) has the molecular formula C24H20N2O3S and a molecular weight of 416.50 g/mol. Its IUPAC name is (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(2-phenylsulfanylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(2-phenylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55493412 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(2-phenylsulfanylphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccccc2Sc2ccccc2)ccc1OCC#N |
| InChI | InChI=1S/C24H20N2O3S/c1-28-22-17-18(11-13-21(22)29-16-15-25)12-14-24(27)26-20-9-5-6-10-23(20)30-19-7-3-2-4-8-19/h2-14,17H,16H2,1H3,(H,26,27)/b14-12+ |
| InChIKey | YMAHRKLGBRGGPR-WYMLVPIESA-N |
| XLogP | 5.40 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|