C25H19N3O4 — CID 24599431
(E)-N-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 24599431) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is (E)-N-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24599431 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (E)-N-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(-c3nc4ccccc4o3)cc2)ccc1OCC#N |
| InChI | InChI=1S/C25H19N3O4/c1-30-23-16-17(6-12-22(23)31-15-14-26)7-13-24(29)27-19-10-8-18(9-11-19)25-28-20-4-2-3-5-21(20)32-25/h2-13,16H,15H2,1H3,(H,27,29)/b13-7+ |
| InChIKey | FEVRWDCPIMTBDA-NTUHNPAUSA-N |
| XLogP | 5.06 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|