C24H18F2N2O4 — CID 16580996
(E)-N-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 16580996) has the molecular formula C24H18F2N2O4 and a molecular weight of 436.41 g/mol. Its IUPAC name is (E)-N-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16580996 |
| Molecular Formula | C24H18F2N2O4 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (E)-N-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(-c3nc4ccccc4o3)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C24H18F2N2O4/c1-30-21-14-15(6-12-20(21)32-24(25)26)7-13-22(29)27-17-10-8-16(9-11-17)23-28-18-4-2-3-5-19(18)31-23/h2-14,24H,1H3,(H,27,29)/b13-7+ |
| InChIKey | UJVDPBLEBXVNMK-NTUHNPAUSA-N |
| XLogP | 5.76 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|