C24H20N2O4 — CID 21214049
(E)-3-(3,4-dimethoxyphenyl)-N-(2-phenyl-1,3-benzoxazol-5-yl)prop-2-enamide (PubChem CID 21214049) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-(2-phenyl-1,3-benzoxazol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-(2-phenyl-1,3-benzoxazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 21214049 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-(2-phenyl-1,3-benzoxazol-5-yl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc3oc(-c4ccccc4)nc3c2)cc1OC |
| InChI | InChI=1S/C24H20N2O4/c1-28-21-11-8-16(14-22(21)29-2)9-13-23(27)25-18-10-12-20-19(15-18)26-24(30-20)17-6-4-3-5-7-17/h3-15H,1-2H3,(H,25,27)/b13-9+ |
| InChIKey | PFEOBIMACIKIRB-UKTHLTGXSA-N |
| XLogP | 5.16 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|