C28H21FN2O5 — CID 17128518
(E)-N-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17128518) has the molecular formula C28H21FN2O5 and a molecular weight of 484.48 g/mol. Its IUPAC name is (E)-N-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17128518 |
| Molecular Formula | C28H21FN2O5 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | (E)-N-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | COc1ccc(-c2nc3cc(NC(=O)/C=C/c4ccc(-c5ccc(F)cc5)o4)ccc3o2)cc1OC |
| InChI | InChI=1S/C28H21FN2O5/c1-33-25-11-5-18(15-26(25)34-2)28-31-22-16-20(8-12-24(22)36-28)30-27(32)14-10-21-9-13-23(35-21)17-3-6-19(29)7-4-17/h3-16H,1-2H3,(H,30,32)/b14-10+ |
| InChIKey | CDIVENPEPBBZCH-GXDHUFHOSA-N |
| XLogP | 6.56 |
| TPSA | 86.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|