C23H20N2O6 — CID 17163371
(E)-3-(furan-2-yl)-N-[2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide (PubChem CID 17163371) has the molecular formula C23H20N2O6 and a molecular weight of 420.42 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17163371 |
| Molecular Formula | C23H20N2O6 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide |
| SMILES | COc1cc(-c2nc3cc(NC(=O)/C=C/c4ccco4)ccc3o2)cc(OC)c1OC |
| InChI | InChI=1S/C23H20N2O6/c1-27-19-11-14(12-20(28-2)22(19)29-3)23-25-17-13-15(6-8-18(17)31-23)24-21(26)9-7-16-5-4-10-30-16/h4-13H,1-3H3,(H,24,26)/b9-7+ |
| InChIKey | URJSYTHLOZNCGA-VQHVLOKHSA-N |
| XLogP | 4.77 |
| TPSA | 95.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|