C22H18N2O4 — CID 2298621
(Z)-N-[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 2298621) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is (Z)-N-[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (Z)-N-[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2298621 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (Z)-N-[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | CCOc1ccc(-c2nc3cc(NC(=O)/C=C\c4ccco4)ccc3o2)cc1 |
| InChI | InChI=1S/C22H18N2O4/c1-2-26-18-8-5-15(6-9-18)22-24-19-14-16(7-11-20(19)28-22)23-21(25)12-10-17-4-3-13-27-17/h3-14H,2H2,1H3,(H,23,25)/b12-10- |
| InChIKey | YMOKWHRZMOBARA-BENRWUELSA-N |
| XLogP | 5.14 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|