C21H16N2O4 — CID 1327368
3-(furan-2-yl)-N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide (PubChem CID 1327368) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1327368 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3-(furan-2-yl)-N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide |
| SMILES | COc1ccc(-c2nc3cc(NC(=O)C=Cc4ccco4)ccc3o2)cc1 |
| InChI | InChI=1S/C21H16N2O4/c1-25-16-7-4-14(5-8-16)21-23-18-13-15(6-10-19(18)27-21)22-20(24)11-9-17-3-2-12-26-17/h2-13H,1H3,(H,22,24) |
| InChIKey | FNQSOJKHAYSTRQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|