C20H12Cl2N2O3 — CID 1109862
N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 1109862) has the molecular formula C20H12Cl2N2O3 and a molecular weight of 399.23 g/mol. Its IUPAC name is N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1109862 |
| Molecular Formula | C20H12Cl2N2O3 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccco1)Nc1ccc2oc(-c3cc(Cl)ccc3Cl)nc2c1 |
| InChI | InChI=1S/C20H12Cl2N2O3/c21-12-3-6-16(22)15(10-12)20-24-17-11-13(4-7-18(17)27-20)23-19(25)8-5-14-2-1-9-26-14/h1-11H,(H,23,25) |
| InChIKey | PQDKMZSXEJCESI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|